About (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene
(3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene (PubChem CID 142839561) has the molecular formula C24H36O
and a molecular weight of 340.55 g/mol. Its IUPAC name is (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene.
Molecular Properties
| Compound Name | (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene |
| PubChem CID | 142839561 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene |
| SMILES | C=C(C)/C=C(\C=C/C)C(C)=O.CCCC(CCC)Cc1ccccc1 |
| InChI | InChI=1S/C14H22.C10H14O/c1-3-8-13(9-4-2)12-14-10-6-5-7-11-14;1-5-6-10(9(4)11)7-8(2)3/h5-7,10-11,13H,3-4,8-9,12H2,1-2H3;5-7H,2H2,1,3-4H3/b;6-5-,10-7+ |
| InChIKey | CDXZJBUAPDUVNN-CFEYKDLNSA-N |
| XLogP | 7.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene?
The IUPAC name of (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene (CID 142839561) is (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene.
What is the SMILES notation for (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene?
The canonical SMILES for (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene is C=C(C)/C=C(\C=C/C)C(C)=O.CCCC(CCC)Cc1ccccc1.
What is the InChIKey of (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene?
The InChIKey is CDXZJBUAPDUVNN-CFEYKDLNSA-N. The full InChI is InChI=1S/C14H22.C10H14O/c1-3-8-13(9-4-2)12-14-10-6-5-7-11-14;1-5-6-10(9(4)11)7-8(2)3/h5-7,10-11,13H,3-4,8-9,12H2,1-2H3;5-7H,2H2,1,3-4H3/b;6-5-,10-7+.
What are the key properties of (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene?
(3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene has a molecular weight of 340.55 g/mol, XLogP of 7.10, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene is sourced from PubChem (CID 142839561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).