C24H36O — CID 142839561
(3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene (PubChem CID 142839561) has the molecular formula C24H36O and a molecular weight of 340.55 g/mol. Its IUPAC name is (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene.
| Compound Name | (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene |
|---|---|
| PubChem CID | 142839561 |
| Molecular Formula | C24H36O |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (3E)-5-methyl-3-[(Z)-prop-1-enyl]hexa-3,5-dien-2-one;2-propylpentylbenzene |
| SMILES | C=C(C)/C=C(\C=C/C)C(C)=O.CCCC(CCC)Cc1ccccc1 |
| InChI | InChI=1S/C14H22.C10H14O/c1-3-8-13(9-4-2)12-14-10-6-5-7-11-14;1-5-6-10(9(4)11)7-8(2)3/h5-7,10-11,13H,3-4,8-9,12H2,1-2H3;5-7H,2H2,1,3-4H3/b;6-5-,10-7+ |
| InChIKey | CDXZJBUAPDUVNN-CFEYKDLNSA-N |
| XLogP | 7.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|