C30H38F3N3O4S — CID 142845811
1-cyclopropyl-4-[methylidene-oxo-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]-λ6-sulfanyl]-N-(oxan-2-yloxy)piperidine-4-carboxamide (PubChem CID 142845811) has the molecular formula C30H38F3N3O4S and a molecular weight of 593.71 g/mol. Its IUPAC name is 1-cyclopropyl-4-[methylidene-oxo-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]-λ6-sulfanyl]-N-(oxan-2-yloxy)piperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-4-[methylidene-oxo-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]-λ6-sulfanyl]-N-(oxan-2-yloxy)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142845811 |
| Molecular Formula | C30H38F3N3O4S |
| Molecular Weight | 593.71 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | 1-cyclopropyl-4-[methylidene-oxo-[4-[5-(4,4,4-trifluorobutyl)-2-pyridinyl]phenyl]-λ6-sulfanyl]-N-(oxan-2-yloxy)piperidine-4-carboxamide |
| SMILES | C=S(=O)(c1ccc(-c2ccc(CCCC(F)(F)F)cn2)cc1)C1(C(=O)NOC2CCCCO2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C30H38F3N3O4S/c1-41(38,25-12-8-23(9-13-25)26-14-7-22(21-34-26)5-4-15-30(31,32)33)29(16-18-36(19-17-29)24-10-11-24)28(37)35-40-27-6-2-3-20-39-27/h7-9,12-14,21,24,27H,1-6,10-11,15-20H2,(H,35,37) |
| InChIKey | IDAMKIJCOYNLBK-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|