C18H12O — CID 142848395
tetracyclo[8.7.1.02,8.014,18]octadeca-1(17),2,4,7,10,12,14(18),15-octaen-9-one (PubChem CID 142848395) has the molecular formula C18H12O and a molecular weight of 244.29 g/mol. Its IUPAC name is tetracyclo[8.7.1.02,8.014,18]octadeca-1(17),2,4,7,10,12,14(18),15-octaen-9-one.
| Compound Name | tetracyclo[8.7.1.02,8.014,18]octadeca-1(17),2,4,7,10,12,14(18),15-octaen-9-one |
|---|---|
| PubChem CID | 142848395 |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | tetracyclo[8.7.1.02,8.014,18]octadeca-1(17),2,4,7,10,12,14(18),15-octaen-9-one |
| SMILES | O=C1C2=CCC=CC=C2c2cccc3cccc1c23 |
| InChI | InChI=1S/C18H12O/c19-18-15-9-3-1-2-8-13(15)14-10-4-6-12-7-5-11-16(18)17(12)14/h1-2,4-11H,3H2 |
| InChIKey | VKRLLKZOSBUGJP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |