C23H28N6O4 — CID 142848699
acetylene;ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate (PubChem CID 142848699) has the molecular formula C23H28N6O4 and a molecular weight of 452.52 g/mol. Its IUPAC name is acetylene;ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate.
| Compound Name | acetylene;ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate |
|---|---|
| PubChem CID | 142848699 |
| Molecular Formula | C23H28N6O4 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | acetylene;ethyl N-[5-amino-3-[4-(butylcarbamoyloxy)phenyl]-1,2-dihydropyrido[3,4-b]pyrazin-7-yl]carbamate |
| SMILES | C#C.CCCCNC(=O)Oc1ccc(C2=Nc3c(cc(NC(=O)OCC)nc3N)NC2)cc1 |
| InChI | InChI=1S/C21H26N6O4.C2H2/c1-3-5-10-23-20(28)31-14-8-6-13(7-9-14)16-12-24-15-11-17(27-21(29)30-4-2)26-19(22)18(15)25-16;1-2/h6-9,11,24H,3-5,10,12H2,1-2H3,(H,23,28)(H3,22,26,27,29);1-2H |
| InChIKey | POGMHOYFUMWMHC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|