C18H26O2S — CID 142850925
(2R)-2-[(4-tert-butylphenyl)methylsulfanyl]-4-methyl-3-methylidenepentanoic acid (PubChem CID 142850925) has the molecular formula C18H26O2S and a molecular weight of 306.47 g/mol. Its IUPAC name is (2R)-2-[(4-tert-butylphenyl)methylsulfanyl]-4-methyl-3-methylidenepentanoic acid.
| Compound Name | (2R)-2-[(4-tert-butylphenyl)methylsulfanyl]-4-methyl-3-methylidenepentanoic acid |
|---|---|
| PubChem CID | 142850925 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (2R)-2-[(4-tert-butylphenyl)methylsulfanyl]-4-methyl-3-methylidenepentanoic acid |
| SMILES | C=C(C(C)C)[C@@H](SCc1ccc(C(C)(C)C)cc1)C(=O)O |
| InChI | InChI=1S/C18H26O2S/c1-12(2)13(3)16(17(19)20)21-11-14-7-9-15(10-8-14)18(4,5)6/h7-10,12,16H,3,11H2,1-2,4-6H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | DWFRYSZHFRFLHA-MRXNPFEDSA-N |
| XLogP | 4.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|