C15H19NO6 — CID 142854131
ethane;7-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-4-nitro-1-benzofuran (PubChem CID 142854131) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is ethane;7-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-4-nitro-1-benzofuran.
| Compound Name | ethane;7-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-4-nitro-1-benzofuran |
|---|---|
| PubChem CID | 142854131 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | ethane;7-methoxy-2-(2-methyl-1,3-dioxolan-2-yl)-4-nitro-1-benzofuran |
| SMILES | CC.COc1ccc([N+](=O)[O-])c2cc(C3(C)OCCO3)oc12 |
| InChI | InChI=1S/C13H13NO6.C2H6/c1-13(18-5-6-19-13)11-7-8-9(14(15)16)3-4-10(17-2)12(8)20-11;1-2/h3-4,7H,5-6H2,1-2H3;1-2H3 |
| InChIKey | FDEYEVXKONPGNL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 83.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|