C17H20O3 — CID 142856403
3-hydroxy-5-[(1E,3E,5E)-6-methoxy-3-methylocta-1,3,5-trienyl]benzaldehyde (PubChem CID 142856403) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-hydroxy-5-[(1E,3E,5E)-6-methoxy-3-methylocta-1,3,5-trienyl]benzaldehyde.
| Compound Name | 3-hydroxy-5-[(1E,3E,5E)-6-methoxy-3-methylocta-1,3,5-trienyl]benzaldehyde |
|---|---|
| PubChem CID | 142856403 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-hydroxy-5-[(1E,3E,5E)-6-methoxy-3-methylocta-1,3,5-trienyl]benzaldehyde |
| SMILES | CC/C(=C\C=C(C)\C=C\c1cc(O)cc(C=O)c1)OC |
| InChI | InChI=1S/C17H20O3/c1-4-17(20-3)8-6-13(2)5-7-14-9-15(12-18)11-16(19)10-14/h5-12,19H,4H2,1-3H3/b7-5+,13-6+,17-8+ |
| InChIKey | RQKREDOCGQVQRY-BXUIKHQISA-N |
| XLogP | 4.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|