C13H13IN4 — CID 142857744
4-iodo-6-[(2Z,4Z,7Z)-1-methyl-6-methylidenecycloocta-2,4,7-trien-1-yl]-1,3,5-triazin-2-amine (PubChem CID 142857744) has the molecular formula C13H13IN4 and a molecular weight of 352.18 g/mol. Its IUPAC name is 4-iodo-6-[(2Z,4Z,7Z)-1-methyl-6-methylidenecycloocta-2,4,7-trien-1-yl]-1,3,5-triazin-2-amine.
| Compound Name | 4-iodo-6-[(2Z,4Z,7Z)-1-methyl-6-methylidenecycloocta-2,4,7-trien-1-yl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 142857744 |
| Molecular Formula | C13H13IN4 |
| Molecular Weight | 352.18 g/mol |
| Exact Mass | 352.02 |
| IUPAC Name | 4-iodo-6-[(2Z,4Z,7Z)-1-methyl-6-methylidenecycloocta-2,4,7-trien-1-yl]-1,3,5-triazin-2-amine |
| SMILES | C=C1/C=C\C=C/C(C)(c2nc(N)nc(I)n2)/C=C\1 |
| InChI | InChI=1S/C13H13IN4/c1-9-5-3-4-7-13(2,8-6-9)10-16-11(14)18-12(15)17-10/h3-8H,1H2,2H3,(H2,15,16,17,18)/b5-3-,7-4-,8-6- |
| InChIKey | VHYNIWRQXUCVKI-CNNSZPCDSA-N |
| XLogP | 2.55 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|