C11H17N5 — CID 89382982
6-(2,5-dimethylhexa-2,4-dien-3-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 89382982) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 6-(2,5-dimethylhexa-2,4-dien-3-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2,5-dimethylhexa-2,4-dien-3-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 89382982 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 6-(2,5-dimethylhexa-2,4-dien-3-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)=CC(=C(C)C)c1nc(N)nc(N)n1 |
| InChI | InChI=1S/C11H17N5/c1-6(2)5-8(7(3)4)9-14-10(12)16-11(13)15-9/h5H,1-4H3,(H4,12,13,14,15,16) |
| InChIKey | GGLKDCWUAXWOHC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|