C18H17N3O5 — CID 142865284
5-cyano-2-(methylamino)benzoic acid;2-(2-hydroxy-4-methoxyphenyl)-2-iminoacetaldehyde (PubChem CID 142865284) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is 5-cyano-2-(methylamino)benzoic acid;2-(2-hydroxy-4-methoxyphenyl)-2-iminoacetaldehyde.
| Compound Name | 5-cyano-2-(methylamino)benzoic acid;2-(2-hydroxy-4-methoxyphenyl)-2-iminoacetaldehyde |
|---|---|
| PubChem CID | 142865284 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 5-cyano-2-(methylamino)benzoic acid;2-(2-hydroxy-4-methoxyphenyl)-2-iminoacetaldehyde |
| SMILES | CNc1ccc(C#N)cc1C(=O)O.[H]/N=C(\C=O)c1ccc(OC)cc1O |
| InChI | InChI=1S/C9H8N2O2.C9H9NO3/c1-11-8-3-2-6(5-10)4-7(8)9(12)13;1-13-6-2-3-7(8(10)5-11)9(12)4-6/h2-4,11H,1H3,(H,12,13);2-5,10,12H,1H3/b;10-8+ |
| InChIKey | ZVXSKXSRAFWSLJ-GIJXAKAHSA-N |
| XLogP | 2.27 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|