C26H21N5O5 — CID 142865493
N-[3-[2-cyano-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]phenyl]acetamide;5-cyano-2-(methylamino)benzoic acid (PubChem CID 142865493) has the molecular formula C26H21N5O5 and a molecular weight of 483.48 g/mol. Its IUPAC name is N-[3-[2-cyano-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]phenyl]acetamide;5-cyano-2-(methylamino)benzoic acid.
| Compound Name | N-[3-[2-cyano-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]phenyl]acetamide;5-cyano-2-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 142865493 |
| Molecular Formula | C26H21N5O5 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | N-[3-[2-cyano-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]phenyl]acetamide;5-cyano-2-(methylamino)benzoic acid |
| SMILES | CNc1ccc(C#N)cc1C(=O)O.[H]/N=C(\C=O)c1cc(-c2cccc(NC(C)=O)c2)c(C#N)cc1O |
| InChI | InChI=1S/C17H13N3O3.C9H8N2O2/c1-10(22)20-13-4-2-3-11(5-13)14-7-15(16(19)9-21)17(23)6-12(14)8-18;1-11-8-3-2-6(5-10)4-7(8)9(12)13/h2-7,9,19,23H,1H3,(H,20,22);2-4,11H,1H3,(H,12,13)/b19-16+; |
| InChIKey | GCJCYNOZCBTIAE-PXMDEAMVSA-N |
| XLogP | 3.75 |
| TPSA | 187.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|