C23H21N5O4S — CID 142865048
5-cyano-2-[[2-(2-hydroxy-4-pyridin-3-yl-5-sulfanylphenyl)-2-iminoacetyl]amino]benzoic acid;ethanamine (PubChem CID 142865048) has the molecular formula C23H21N5O4S and a molecular weight of 463.52 g/mol. Its IUPAC name is 5-cyano-2-[[2-(2-hydroxy-4-pyridin-3-yl-5-sulfanylphenyl)-2-iminoacetyl]amino]benzoic acid;ethanamine.
| Compound Name | 5-cyano-2-[[2-(2-hydroxy-4-pyridin-3-yl-5-sulfanylphenyl)-2-iminoacetyl]amino]benzoic acid;ethanamine |
|---|---|
| PubChem CID | 142865048 |
| Molecular Formula | C23H21N5O4S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 5-cyano-2-[[2-(2-hydroxy-4-pyridin-3-yl-5-sulfanylphenyl)-2-iminoacetyl]amino]benzoic acid;ethanamine |
| SMILES | CCN.[H]/N=C(\C(=O)Nc1ccc(C#N)cc1C(=O)O)c1cc(S)c(-c2cccnc2)cc1O |
| InChI | InChI=1S/C21H14N4O4S.C2H7N/c22-9-11-3-4-16(14(6-11)21(28)29)25-20(27)19(23)15-8-18(30)13(7-17(15)26)12-2-1-5-24-10-12;1-2-3/h1-8,10,23,26,30H,(H,25,27)(H,28,29);2-3H2,1H3/b23-19-; |
| InChIKey | OPCYHFXQQIWFJF-PDEWKSAASA-N |
| XLogP | 3.28 |
| TPSA | 173.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|