C24H19N5O6S — CID 142865342
2-[[2-[5-aminosulfanyl-2-hydroxy-4-[4-(methoxycarbonylamino)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid (PubChem CID 142865342) has the molecular formula C24H19N5O6S and a molecular weight of 505.51 g/mol. Its IUPAC name is 2-[[2-[5-aminosulfanyl-2-hydroxy-4-[4-(methoxycarbonylamino)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid.
| Compound Name | 2-[[2-[5-aminosulfanyl-2-hydroxy-4-[4-(methoxycarbonylamino)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid |
|---|---|
| PubChem CID | 142865342 |
| Molecular Formula | C24H19N5O6S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 2-[[2-[5-aminosulfanyl-2-hydroxy-4-[4-(methoxycarbonylamino)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(C#N)cc1C(=O)O)c1cc(SN)c(-c2ccc(NC(=O)OC)cc2)cc1O |
| InChI | InChI=1S/C24H19N5O6S/c1-35-24(34)28-14-5-3-13(4-6-14)15-9-19(30)17(10-20(15)36-27)21(26)22(31)29-18-7-2-12(11-25)8-16(18)23(32)33/h2-10,26,30H,27H2,1H3,(H,28,34)(H,29,31)(H,32,33)/b26-21- |
| InChIKey | IDXORSHHHWFGPC-QLYXXIJNSA-N |
| XLogP | 3.78 |
| TPSA | 198.62 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|