C27H22F3N5O7 — CID 142865136
5-cyano-2-(methylamino)benzoic acid;methyl N-[4-[2-carbamoyl-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]-3-(trifluoromethyl)phenyl]carbamate (PubChem CID 142865136) has the molecular formula C27H22F3N5O7 and a molecular weight of 585.50 g/mol. Its IUPAC name is 5-cyano-2-(methylamino)benzoic acid;methyl N-[4-[2-carbamoyl-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]-3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | 5-cyano-2-(methylamino)benzoic acid;methyl N-[4-[2-carbamoyl-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]-3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 142865136 |
| Molecular Formula | C27H22F3N5O7 |
| Molecular Weight | 585.50 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 5-cyano-2-(methylamino)benzoic acid;methyl N-[4-[2-carbamoyl-4-hydroxy-5-(2-oxoethanimidoyl)phenyl]-3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CNc1ccc(C#N)cc1C(=O)O.[H]/N=C(\C=O)c1cc(-c2ccc(NC(=O)OC)cc2C(F)(F)F)c(C(N)=O)cc1O |
| InChI | InChI=1S/C18H14F3N3O5.C9H8N2O2/c1-29-17(28)24-8-2-3-9(13(4-8)18(19,20)21)10-5-12(14(22)7-25)15(26)6-11(10)16(23)27;1-11-8-3-2-6(5-10)4-7(8)9(12)13/h2-7,22,26H,1H3,(H2,23,27)(H,24,28);2-4,11H,1H3,(H,12,13)/b22-14+; |
| InChIKey | WLKBTGDTCMEZLD-CWUUNJJBSA-N |
| XLogP | 4.22 |
| TPSA | 215.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|