C23H17N3O5S — CID 142865450
5-cyano-2-[[2-[2-hydroxy-4-(2-methoxyphenyl)-5-sulfanylphenyl]-2-iminoacetyl]amino]benzoic acid (PubChem CID 142865450) has the molecular formula C23H17N3O5S and a molecular weight of 447.47 g/mol. Its IUPAC name is 5-cyano-2-[[2-[2-hydroxy-4-(2-methoxyphenyl)-5-sulfanylphenyl]-2-iminoacetyl]amino]benzoic acid.
| Compound Name | 5-cyano-2-[[2-[2-hydroxy-4-(2-methoxyphenyl)-5-sulfanylphenyl]-2-iminoacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 142865450 |
| Molecular Formula | C23H17N3O5S |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 5-cyano-2-[[2-[2-hydroxy-4-(2-methoxyphenyl)-5-sulfanylphenyl]-2-iminoacetyl]amino]benzoic acid |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(C#N)cc1C(=O)O)c1cc(S)c(-c2ccccc2OC)cc1O |
| InChI | InChI=1S/C23H17N3O5S/c1-31-19-5-3-2-4-13(19)14-9-18(27)16(10-20(14)32)21(25)22(28)26-17-7-6-12(11-24)8-15(17)23(29)30/h2-10,25,27,32H,1H3,(H,26,28)(H,29,30)/b25-21- |
| InChIKey | QBLXRXJXOFAYOO-DAFNUICNSA-N |
| XLogP | 3.93 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|