C20H20N4O8S — CID 142865107
2-[[2-[4-[bis(2-hydroxyethyl)sulfamoyl]-2-hydroxyphenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid (PubChem CID 142865107) has the molecular formula C20H20N4O8S and a molecular weight of 476.47 g/mol. Its IUPAC name is 2-[[2-[4-[bis(2-hydroxyethyl)sulfamoyl]-2-hydroxyphenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid.
| Compound Name | 2-[[2-[4-[bis(2-hydroxyethyl)sulfamoyl]-2-hydroxyphenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid |
|---|---|
| PubChem CID | 142865107 |
| Molecular Formula | C20H20N4O8S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-[[2-[4-[bis(2-hydroxyethyl)sulfamoyl]-2-hydroxyphenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(C#N)cc1C(=O)O)c1ccc(S(=O)(=O)N(CCO)CCO)cc1O |
| InChI | InChI=1S/C20H20N4O8S/c21-11-12-1-4-16(15(9-12)20(29)30)23-19(28)18(22)14-3-2-13(10-17(14)27)33(31,32)24(5-7-25)6-8-26/h1-4,9-10,22,25-27H,5-8H2,(H,23,28)(H,29,30)/b22-18- |
| InChIKey | GTDODVXDPNBGAM-PYCFMQQDSA-N |
| XLogP | -0.06 |
| TPSA | 212.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|