C22H16N6O5 — CID 142865289
2-[[2-(4-acetamido-2-hydroxy-5-pyridazin-3-ylphenyl)-2-iminoacetyl]amino]-5-cyanobenzoic acid (PubChem CID 142865289) has the molecular formula C22H16N6O5 and a molecular weight of 444.41 g/mol. Its IUPAC name is 2-[[2-(4-acetamido-2-hydroxy-5-pyridazin-3-ylphenyl)-2-iminoacetyl]amino]-5-cyanobenzoic acid.
| Compound Name | 2-[[2-(4-acetamido-2-hydroxy-5-pyridazin-3-ylphenyl)-2-iminoacetyl]amino]-5-cyanobenzoic acid |
|---|---|
| PubChem CID | 142865289 |
| Molecular Formula | C22H16N6O5 |
| Molecular Weight | 444.41 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 2-[[2-(4-acetamido-2-hydroxy-5-pyridazin-3-ylphenyl)-2-iminoacetyl]amino]-5-cyanobenzoic acid |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(C#N)cc1C(=O)O)c1cc(-c2cccnn2)c(NC(C)=O)cc1O |
| InChI | InChI=1S/C22H16N6O5/c1-11(29)26-18-9-19(30)15(8-13(18)17-3-2-6-25-28-17)20(24)21(31)27-16-5-4-12(10-23)7-14(16)22(32)33/h2-9,24,30H,1H3,(H,26,29)(H,27,31)(H,32,33)/b24-20- |
| InChIKey | DGQAYFPPBRCNIV-GFMRDNFCSA-N |
| XLogP | 2.38 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|