C25H17F3N4O5 — CID 142865192
2-[[2-[4-acetamido-2-hydroxy-5-[2-(trifluoromethyl)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid (PubChem CID 142865192) has the molecular formula C25H17F3N4O5 and a molecular weight of 510.43 g/mol. Its IUPAC name is 2-[[2-[4-acetamido-2-hydroxy-5-[2-(trifluoromethyl)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid.
| Compound Name | 2-[[2-[4-acetamido-2-hydroxy-5-[2-(trifluoromethyl)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid |
|---|---|
| PubChem CID | 142865192 |
| Molecular Formula | C25H17F3N4O5 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 510.12 |
| IUPAC Name | 2-[[2-[4-acetamido-2-hydroxy-5-[2-(trifluoromethyl)phenyl]phenyl]-2-iminoacetyl]amino]-5-cyanobenzoic acid |
| SMILES | [H]/N=C(\C(=O)Nc1ccc(C#N)cc1C(=O)O)c1cc(-c2ccccc2C(F)(F)F)c(NC(C)=O)cc1O |
| InChI | InChI=1S/C25H17F3N4O5/c1-12(33)31-20-10-21(34)17(9-15(20)14-4-2-3-5-18(14)25(26,27)28)22(30)23(35)32-19-7-6-13(11-29)8-16(19)24(36)37/h2-10,30,34H,1H3,(H,31,33)(H,32,35)(H,36,37)/b30-22- |
| InChIKey | DLNCXKHRKZWPCT-SWKFRHMKSA-N |
| XLogP | 4.61 |
| TPSA | 163.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|