About (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene
(4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene (PubChem CID 142865381) has the molecular formula C17H19P
and a molecular weight of 254.31 g/mol. Its IUPAC name is (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene.
Molecular Properties
| Compound Name | (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene |
| PubChem CID | 142865381 |
| Molecular Formula | C17H19P |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene |
| SMILES | C#Cc1ccccc1C.CCc1ccc(P)cc1 |
| InChI | InChI=1S/C9H8.C8H11P/c1-3-9-7-5-4-6-8(9)2;1-2-7-3-5-8(9)6-4-7/h1,4-7H,2H3;3-6H,2,9H2,1H3 |
| InChIKey | QOXOINHANLHEFH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene?
The IUPAC name of (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene (CID 142865381) is (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene.
What is the SMILES notation for (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene?
The canonical SMILES for (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene is C#Cc1ccccc1C.CCc1ccc(P)cc1.
What is the InChIKey of (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene?
The InChIKey is QOXOINHANLHEFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8.C8H11P/c1-3-9-7-5-4-6-8(9)2;1-2-7-3-5-8(9)6-4-7/h1,4-7H,2H3;3-6H,2,9H2,1H3.
What are the key properties of (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene?
(4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene has a molecular weight of 254.31 g/mol, XLogP of 3.73, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl)phosphane;1-ethynyl-2-methylbenzene is sourced from PubChem (CID 142865381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).