C22H30O — CID 142867979
ethane;ethenone;2-methyl-4-[(2Z,4Z,6Z)-octa-2,4,6-trienyl]-1-[(Z)-prop-1-enyl]benzene (PubChem CID 142867979) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is ethane;ethenone;2-methyl-4-[(2Z,4Z,6Z)-octa-2,4,6-trienyl]-1-[(Z)-prop-1-enyl]benzene.
| Compound Name | ethane;ethenone;2-methyl-4-[(2Z,4Z,6Z)-octa-2,4,6-trienyl]-1-[(Z)-prop-1-enyl]benzene |
|---|---|
| PubChem CID | 142867979 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | ethane;ethenone;2-methyl-4-[(2Z,4Z,6Z)-octa-2,4,6-trienyl]-1-[(Z)-prop-1-enyl]benzene |
| SMILES | C/C=C\C=C/C=C\Cc1ccc(/C=C\C)c(C)c1.C=C=O.CC |
| InChI | InChI=1S/C18H22.C2H2O.C2H6/c1-4-6-7-8-9-10-12-17-13-14-18(11-5-2)16(3)15-17;1-2-3;1-2/h4-11,13-15H,12H2,1-3H3;1H2;1-2H3/b6-4-,8-7-,10-9-,11-5-;; |
| InChIKey | ZBIWFDPVOYJYQJ-ONAODWIESA-N |
| XLogP | 6.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|