C11H19NO — CID 142883987
2-hexan-3-yl-4,5-dimethyl-1,3-oxazole (PubChem CID 142883987) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-hexan-3-yl-4,5-dimethyl-1,3-oxazole.
| Compound Name | 2-hexan-3-yl-4,5-dimethyl-1,3-oxazole |
|---|---|
| PubChem CID | 142883987 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-hexan-3-yl-4,5-dimethyl-1,3-oxazole |
| SMILES | CCCC(CC)c1nc(C)c(C)o1 |
| InChI | InChI=1S/C11H19NO/c1-5-7-10(6-2)11-12-8(3)9(4)13-11/h10H,5-7H2,1-4H3 |
| InChIKey | PAVCHMUOGHOIOS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |