C40H42N4O4 — CID 142884867
3-[3-[13-amino-12-[3-(3-hydroxypropoxy)phenyl]-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1(21),2,4,6,8(22),9,11,13,15,17,19-undecaen-2-yl]phenoxy]propan-1-ol;ethane (PubChem CID 142884867) has the molecular formula C40H42N4O4 and a molecular weight of 642.80 g/mol. Its IUPAC name is 3-[3-[13-amino-12-[3-(3-hydroxypropoxy)phenyl]-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1(21),2,4,6,8(22),9,11,13,15,17,19-undecaen-2-yl]phenoxy]propan-1-ol;ethane.
| Compound Name | 3-[3-[13-amino-12-[3-(3-hydroxypropoxy)phenyl]-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1(21),2,4,6,8(22),9,11,13,15,17,19-undecaen-2-yl]phenoxy]propan-1-ol;ethane |
|---|---|
| PubChem CID | 142884867 |
| Molecular Formula | C40H42N4O4 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | 3-[3-[13-amino-12-[3-(3-hydroxypropoxy)phenyl]-21,22,23-triazatetracyclo[16.2.1.13,6.18,11]tricosa-1(21),2,4,6,8(22),9,11,13,15,17,19-undecaen-2-yl]phenoxy]propan-1-ol;ethane |
| SMILES | CC.Nc1ccccc2nc(c(-c3cccc(OCCCO)c3)c3ccc(cc4nc(c1-c1cccc(OCCCO)c1)C=C4)[nH]3)C=C2 |
| InChI | InChI=1S/C38H36N4O4.C2H6/c39-33-12-2-1-9-28-13-16-35(40-28)38(27-8-4-11-32(24-27)46-22-6-20-44)36-18-15-30(42-36)25-29-14-17-34(41-29)37(33)26-7-3-10-31(23-26)45-21-5-19-43;1-2/h1-4,7-18,23-25,42-44H,5-6,19-22,39H2;1-2H3/b2-1-,9-1-,12-2+,28-9+,29-25-,30-25-,33-12-,37-33+,37-34-,38-35+,38-36-; |
| InChIKey | ZSTBBIKWOMZUMI-RCHROANWSA-N |
| XLogP | 8.20 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|