C18H27N — CID 142893781
5-cyclohex-2-en-1-yl-6-cyclohex-3-en-1-yl-3-methyl-2,3,4,5-tetrahydropyridine (PubChem CID 142893781) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 5-cyclohex-2-en-1-yl-6-cyclohex-3-en-1-yl-3-methyl-2,3,4,5-tetrahydropyridine.
| Compound Name | 5-cyclohex-2-en-1-yl-6-cyclohex-3-en-1-yl-3-methyl-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 142893781 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 5-cyclohex-2-en-1-yl-6-cyclohex-3-en-1-yl-3-methyl-2,3,4,5-tetrahydropyridine |
| SMILES | CC1CN=C(C2CC=CCC2)C(C2C=CCCC2)C1 |
| InChI | InChI=1S/C18H27N/c1-14-12-17(15-8-4-2-5-9-15)18(19-13-14)16-10-6-3-7-11-16/h3-4,6,8,14-17H,2,5,7,9-13H2,1H3 |
| InChIKey | RKQRGWVULJTSFL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|