About 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole
1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole (PubChem CID 142903013) has the molecular formula C16H19NO2
and a molecular weight of 257.33 g/mol. Its IUPAC name is 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole.
Molecular Properties
| Compound Name | 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole |
| PubChem CID | 142903013 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole |
| SMILES | C=Cc1ccc(OC)cc1.Cc1onc2c1CCC2 |
| InChI | InChI=1S/C9H10O.C7H9NO/c1-3-8-4-6-9(10-2)7-5-8;1-5-6-3-2-4-7(6)8-9-5/h3-7H,1H2,2H3;2-4H2,1H3 |
| InChIKey | AQAGSCYKDHXKIZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole?
The IUPAC name of 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole (CID 142903013) is 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole.
What is the SMILES notation for 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole?
The canonical SMILES for 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole is C=Cc1ccc(OC)cc1.Cc1onc2c1CCC2.
What is the InChIKey of 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole?
The InChIKey is AQAGSCYKDHXKIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.C7H9NO/c1-3-8-4-6-9(10-2)7-5-8;1-5-6-3-2-4-7(6)8-9-5/h3-7H,1H2,2H3;2-4H2,1H3.
What are the key properties of 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole?
1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole has a molecular weight of 257.33 g/mol, XLogP of 3.81, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4-methoxybenzene;3-methyl-5,6-dihydro-4H-cyclopenta[c][1,2]oxazole is sourced from PubChem (CID 142903013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).