C11H17NS — CID 142918247
(3Z,5E)-7-methyliminodeca-1,3,5-triene-4-thiol (PubChem CID 142918247) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is (3Z,5E)-7-methyliminodeca-1,3,5-triene-4-thiol.
| Compound Name | (3Z,5E)-7-methyliminodeca-1,3,5-triene-4-thiol |
|---|---|
| PubChem CID | 142918247 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (3Z,5E)-7-methyliminodeca-1,3,5-triene-4-thiol |
| SMILES | C=C/C=C(S)/C=C/C(CCC)=N/C |
| InChI | InChI=1S/C11H17NS/c1-4-6-10(12-3)8-9-11(13)7-5-2/h5,7-9,13H,2,4,6H2,1,3H3/b9-8+,11-7-,12-10+ |
| InChIKey | WJHZCZKIEWHAJL-LFACANGYSA-N |
| XLogP | 3.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|