C13H17S+ — CID 142925736
1-(2,3-dihydro-1H-inden-2-yl)thiolan-1-ium (PubChem CID 142925736) has the molecular formula C13H17S+ and a molecular weight of 205.35 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-2-yl)thiolan-1-ium.
| Compound Name | 1-(2,3-dihydro-1H-inden-2-yl)thiolan-1-ium |
|---|---|
| PubChem CID | 142925736 |
| Molecular Formula | C13H17S+ |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-2-yl)thiolan-1-ium |
| SMILES | c1ccc2c(c1)CC([S+]1CCCC1)C2 |
| InChI | InChI=1S/C13H17S/c1-2-6-12-10-13(9-11(12)5-1)14-7-3-4-8-14/h1-2,5-6,13H,3-4,7-10H2/q+1 |
| InChIKey | DRPWUCBUNBKUJF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|