C22H31FN4O2 — CID 142930542
[4-[4-(3-aminophenyl)piperazin-1-yl]butylamino] formate;1-fluoro-4-methylbenzene (PubChem CID 142930542) has the molecular formula C22H31FN4O2 and a molecular weight of 402.51 g/mol. Its IUPAC name is [4-[4-(3-aminophenyl)piperazin-1-yl]butylamino] formate;1-fluoro-4-methylbenzene.
| Compound Name | [4-[4-(3-aminophenyl)piperazin-1-yl]butylamino] formate;1-fluoro-4-methylbenzene |
|---|---|
| PubChem CID | 142930542 |
| Molecular Formula | C22H31FN4O2 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | [4-[4-(3-aminophenyl)piperazin-1-yl]butylamino] formate;1-fluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)cc1.Nc1cccc(N2CCN(CCCCNOC=O)CC2)c1 |
| InChI | InChI=1S/C15H24N4O2.C7H7F/c16-14-4-3-5-15(12-14)19-10-8-18(9-11-19)7-2-1-6-17-21-13-20;1-6-2-4-7(8)5-3-6/h3-5,12-13,17H,1-2,6-11,16H2;2-5H,1H3 |
| InChIKey | ACCJAMWLMJOXBC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|