C25H29N3O — CID 142931080
(E)-N-[4-[2-(dimethylamino)butylamino]phenyl]-3-naphthalen-1-ylprop-2-enamide (PubChem CID 142931080) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is (E)-N-[4-[2-(dimethylamino)butylamino]phenyl]-3-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-N-[4-[2-(dimethylamino)butylamino]phenyl]-3-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 142931080 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | (E)-N-[4-[2-(dimethylamino)butylamino]phenyl]-3-naphthalen-1-ylprop-2-enamide |
| SMILES | CCC(CNc1ccc(NC(=O)/C=C/c2cccc3ccccc23)cc1)N(C)C |
| InChI | InChI=1S/C25H29N3O/c1-4-23(28(2)3)18-26-21-13-15-22(16-14-21)27-25(29)17-12-20-10-7-9-19-8-5-6-11-24(19)20/h5-17,23,26H,4,18H2,1-3H3,(H,27,29)/b17-12+ |
| InChIKey | AXLWKLTZAKUSGK-SFQUDFHCSA-N |
| XLogP | 5.24 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|