C11H21NO — CID 142940143
(Z)-6-[methyl(2-methylpropyl)amino]hex-4-enal (PubChem CID 142940143) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (Z)-6-[methyl(2-methylpropyl)amino]hex-4-enal.
| Compound Name | (Z)-6-[methyl(2-methylpropyl)amino]hex-4-enal |
|---|---|
| PubChem CID | 142940143 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (Z)-6-[methyl(2-methylpropyl)amino]hex-4-enal |
| SMILES | CC(C)CN(C)C/C=C\CCC=O |
| InChI | InChI=1S/C11H21NO/c1-11(2)10-12(3)8-6-4-5-7-9-13/h4,6,9,11H,5,7-8,10H2,1-3H3/b6-4- |
| InChIKey | YMOCXHHYHHOGQQ-XQRVVYSFSA-N |
| XLogP | 2.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|