C21H25N3O5 — CID 142944533
ethyl 2-[[2-(6,8-dihydroxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]acetate (PubChem CID 142944533) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 2-[[2-(6,8-dihydroxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[2-(6,8-dihydroxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 142944533 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 2-[[2-(6,8-dihydroxy-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccccc1C1CN(C)Cc2c(O)cc(O)cc21 |
| InChI | InChI=1S/C21H25N3O5/c1-3-29-20(27)10-22-21(28)23-18-7-5-4-6-14(18)16-11-24(2)12-17-15(16)8-13(25)9-19(17)26/h4-9,16,25-26H,3,10-12H2,1-2H3,(H2,22,23,28) |
| InChIKey | FHAHLZRGYXAPKS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|