C13H20ClN3O2S — CID 142971433
1-(3-butylsulfinamoylphenyl)-3-(2-chloroethyl)urea (PubChem CID 142971433) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 1-(3-butylsulfinamoylphenyl)-3-(2-chloroethyl)urea.
| Compound Name | 1-(3-butylsulfinamoylphenyl)-3-(2-chloroethyl)urea |
|---|---|
| PubChem CID | 142971433 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 1-(3-butylsulfinamoylphenyl)-3-(2-chloroethyl)urea |
| SMILES | CCCCNS(=O)c1cccc(NC(=O)NCCCl)c1 |
| InChI | InChI=1S/C13H20ClN3O2S/c1-2-3-8-16-20(19)12-6-4-5-11(10-12)17-13(18)15-9-7-14/h4-6,10,16H,2-3,7-9H2,1H3,(H2,15,17,18) |
| InChIKey | ZUVRGTYGLMHCLL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|