C13H21N — CID 142977275
5-methyl-5-[(3E,5Z)-octa-3,5-dien-3-yl]-1,2-dihydropyrrole (PubChem CID 142977275) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 5-methyl-5-[(3E,5Z)-octa-3,5-dien-3-yl]-1,2-dihydropyrrole.
| Compound Name | 5-methyl-5-[(3E,5Z)-octa-3,5-dien-3-yl]-1,2-dihydropyrrole |
|---|---|
| PubChem CID | 142977275 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 5-methyl-5-[(3E,5Z)-octa-3,5-dien-3-yl]-1,2-dihydropyrrole |
| SMILES | CC/C=C\C=C(/CC)C1(C)C=CCN1 |
| InChI | InChI=1S/C13H21N/c1-4-6-7-9-12(5-2)13(3)10-8-11-14-13/h6-10,14H,4-5,11H2,1-3H3/b7-6-,12-9+ |
| InChIKey | NCCBSOVBNPQQIS-IYNHQRNQSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|