C25H40 — CID 142981642
(3R)-17-[(Z)-but-2-enyl]-13-ethenyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 142981642) has the molecular formula C25H40 and a molecular weight of 340.60 g/mol. Its IUPAC name is (3R)-17-[(Z)-but-2-enyl]-13-ethenyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3R)-17-[(Z)-but-2-enyl]-13-ethenyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 142981642 |
| Molecular Formula | C25H40 |
| Molecular Weight | 340.60 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | (3R)-17-[(Z)-but-2-enyl]-13-ethenyl-3,10-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C=CC12CCC3C(CCC4C[C@H](C)CCC43C)C1CCC2C/C=C\C |
| InChI | InChI=1S/C25H40/c1-5-7-8-19-10-12-23-21-11-9-20-17-18(3)13-15-24(20,4)22(21)14-16-25(19,23)6-2/h5-7,18-23H,2,8-17H2,1,3-4H3/b7-5-/t18-,19?,20?,21?,22?,23?,24?,25?/m1/s1 |
| InChIKey | SDAGBLOLCKUSJB-NBSNQITISA-N |
| XLogP | 7.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.60 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|