C42H37ClFN7O4 — CID 142985067
7-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]-N-(3-chloro-4-fluorophenyl)-4-(1,2-dihydropyridin-4-ylmethyl)phthalazin-1-amine (PubChem CID 142985067) has the molecular formula C42H37ClFN7O4 and a molecular weight of 758.25 g/mol. Its IUPAC name is 7-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]-N-(3-chloro-4-fluorophenyl)-4-(1,2-dihydropyridin-4-ylmethyl)phthalazin-1-amine.
| Compound Name | 7-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]-N-(3-chloro-4-fluorophenyl)-4-(1,2-dihydropyridin-4-ylmethyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 142985067 |
| Molecular Formula | C42H37ClFN7O4 |
| Molecular Weight | 758.25 g/mol |
| Exact Mass | 757.26 |
| IUPAC Name | 7-[2-[3-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]phenyl]ethynyl]-N-(3-chloro-4-fluorophenyl)-4-(1,2-dihydropyridin-4-ylmethyl)phthalazin-1-amine |
| SMILES | COCCOc1cc2ncnc(Nc3cccc(C#Cc4ccc5c(CC6=CCNC=C6)nnc(Nc6ccc(F)c(Cl)c6)c5c4)c3)c2cc1OCCOC |
| InChI | InChI=1S/C42H37ClFN7O4/c1-52-16-18-54-39-24-34-37(25-40(39)55-19-17-53-2)46-26-47-41(34)48-30-5-3-4-27(20-30)6-7-28-8-10-32-33(21-28)42(49-31-9-11-36(44)35(43)23-31)51-50-38(32)22-29-12-14-45-15-13-29/h3-5,8-14,20-21,23-26,45H,15-19,22H2,1-2H3,(H,49,51)(H,46,47,48) |
| InChIKey | LZZHPUABZKKASS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.25 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|