C22H20Cl2N6O — CID 142988504
5-(4-chlorophenyl)-N'-[(2-chlorophenyl)methyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 142988504) has the molecular formula C22H20Cl2N6O and a molecular weight of 455.35 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-[(2-chlorophenyl)methyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-[(2-chlorophenyl)methyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 142988504 |
| Molecular Formula | C22H20Cl2N6O |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-[(2-chlorophenyl)methyl]-N-cyano-4-(2-oxopyrrolidin-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\Cc1ccccc1Cl)N1CC(N2CCCC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C22H20Cl2N6O/c23-17-9-7-15(8-10-17)21-19(29-11-3-6-20(29)31)13-30(28-21)22(27-14-25)26-12-16-4-1-2-5-18(16)24/h1-2,4-5,7-10,19H,3,6,11-13H2,(H,26,27) |
| InChIKey | RAZCSTXFMLSMRK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 84.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|