C23H20Cl2N6O2 — CID 54719275
5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)ethyl]-N-cyano-4-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydropyrazole-2-carboximidamide (PubChem CID 54719275) has the molecular formula C23H20Cl2N6O2 and a molecular weight of 483.36 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)ethyl]-N-cyano-4-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydropyrazole-2-carboximidamide.
| Compound Name | 5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)ethyl]-N-cyano-4-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
|---|---|
| PubChem CID | 54719275 |
| Molecular Formula | C23H20Cl2N6O2 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.10 |
| IUPAC Name | 5-(4-chlorophenyl)-N'-[2-(4-chlorophenyl)ethyl]-N-cyano-4-(3-hydroxy-5-oxo-2H-pyrrol-1-yl)-3,4-dihydropyrazole-2-carboximidamide |
| SMILES | N#CN/C(=N\CCc1ccc(Cl)cc1)N1CC(N2CC(O)=CC2=O)C(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C23H20Cl2N6O2/c24-17-5-1-15(2-6-17)9-10-27-23(28-14-26)31-13-20(30-12-19(32)11-21(30)33)22(29-31)16-3-7-18(25)8-4-16/h1-8,11,20,32H,9-10,12-13H2,(H,27,28) |
| InChIKey | WRWQQHYQTRDSAJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|