C20H24N2 — CID 142992192
5-(8-methyl-11H-benzo[c][1]benzazepin-6-yl)pentan-1-amine (PubChem CID 142992192) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 5-(8-methyl-11H-benzo[c][1]benzazepin-6-yl)pentan-1-amine.
| Compound Name | 5-(8-methyl-11H-benzo[c][1]benzazepin-6-yl)pentan-1-amine |
|---|---|
| PubChem CID | 142992192 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 5-(8-methyl-11H-benzo[c][1]benzazepin-6-yl)pentan-1-amine |
| SMILES | Cc1ccc2c(c1)C(CCCCCN)=Nc1ccccc1C2 |
| InChI | InChI=1S/C20H24N2/c1-15-10-11-16-14-17-7-4-5-8-19(17)22-20(18(16)13-15)9-3-2-6-12-21/h4-5,7-8,10-11,13H,2-3,6,9,12,14,21H2,1H3 |
| InChIKey | VDMBNDCIIXCMCH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|