C31H43NO3 — CID 142999634
1-cyclooctyl-2-(4-ethoxyphenyl)-3-methylindole-5-carboxylic acid;pentane (PubChem CID 142999634) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is 1-cyclooctyl-2-(4-ethoxyphenyl)-3-methylindole-5-carboxylic acid;pentane.
| Compound Name | 1-cyclooctyl-2-(4-ethoxyphenyl)-3-methylindole-5-carboxylic acid;pentane |
|---|---|
| PubChem CID | 142999634 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 1-cyclooctyl-2-(4-ethoxyphenyl)-3-methylindole-5-carboxylic acid;pentane |
| SMILES | CCCCC.CCOc1ccc(-c2c(C)c3cc(C(=O)O)ccc3n2C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C26H31NO3.C5H12/c1-3-30-22-14-11-19(12-15-22)25-18(2)23-17-20(26(28)29)13-16-24(23)27(25)21-9-7-5-4-6-8-10-21;1-3-5-4-2/h11-17,21H,3-10H2,1-2H3,(H,28,29);3-5H2,1-2H3 |
| InChIKey | USCUGNWCHHAJKT-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |