C6H11NO2 — CID 143006357
2-ethyl-4-methyl-1,2-oxazolidin-5-one (PubChem CID 143006357) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-ethyl-4-methyl-1,2-oxazolidin-5-one.
| Compound Name | 2-ethyl-4-methyl-1,2-oxazolidin-5-one |
|---|---|
| PubChem CID | 143006357 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-ethyl-4-methyl-1,2-oxazolidin-5-one |
| SMILES | CCN1CC(C)C(=O)O1 |
| InChI | InChI=1S/C6H11NO2/c1-3-7-4-5(2)6(8)9-7/h5H,3-4H2,1-2H3 |
| InChIKey | KQRBDCKVHQJTBA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |