C26H30N2O4 — CID 143014079
(Z)-2-[[(E)-1-amino-3-phenylprop-2-enylidene]amino]but-2-enoic acid;(E)-4-phenylbut-3-enoic acid;prop-1-ene (PubChem CID 143014079) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (Z)-2-[[(E)-1-amino-3-phenylprop-2-enylidene]amino]but-2-enoic acid;(E)-4-phenylbut-3-enoic acid;prop-1-ene.
| Compound Name | (Z)-2-[[(E)-1-amino-3-phenylprop-2-enylidene]amino]but-2-enoic acid;(E)-4-phenylbut-3-enoic acid;prop-1-ene |
|---|---|
| PubChem CID | 143014079 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (Z)-2-[[(E)-1-amino-3-phenylprop-2-enylidene]amino]but-2-enoic acid;(E)-4-phenylbut-3-enoic acid;prop-1-ene |
| SMILES | C/C=C(\N=C(N)\C=C\c1ccccc1)C(=O)O.C=CC.O=C(O)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H14N2O2.C10H10O2.C3H6/c1-2-11(13(16)17)15-12(14)9-8-10-6-4-3-5-7-10;11-10(12)8-4-7-9-5-2-1-3-6-9;1-3-2/h2-9H,1H3,(H2,14,15)(H,16,17);1-7H,8H2,(H,11,12);3H,1H2,2H3/b9-8+,11-2-;7-4+; |
| InChIKey | UGBAUVBLCQRVNU-HRZIZICFSA-N |
| XLogP | 5.41 |
| TPSA | 112.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|