C10H23NO — CID 143024131
ethane;(E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol (PubChem CID 143024131) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is ethane;(E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol.
| Compound Name | ethane;(E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol |
|---|---|
| PubChem CID | 143024131 |
| Molecular Formula | C10H23NO |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.18 |
| IUPAC Name | ethane;(E,4S)-2-methyl-4-(methylamino)hex-2-en-1-ol |
| SMILES | CC.CC[C@@H](/C=C(\C)CO)NC |
| InChI | InChI=1S/C8H17NO.C2H6/c1-4-8(9-3)5-7(2)6-10;1-2/h5,8-10H,4,6H2,1-3H3;1-2H3/b7-5+;/t8-;/m0./s1 |
| InChIKey | VCHCNUQAIJNTMT-FPOHDNNASA-N |
| XLogP | 1.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|