C24H34ClF4N2O2+ — CID 143024530
chloromethane;2-[[3-ethyl-2-(ethylamino)pyridin-1-ium-1-yl]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol (PubChem CID 143024530) has the molecular formula C24H34ClF4N2O2+ and a molecular weight of 493.99 g/mol. Its IUPAC name is chloromethane;2-[[3-ethyl-2-(ethylamino)pyridin-1-ium-1-yl]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol.
| Compound Name | chloromethane;2-[[3-ethyl-2-(ethylamino)pyridin-1-ium-1-yl]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 143024530 |
| Molecular Formula | C24H34ClF4N2O2+ |
| Molecular Weight | 493.99 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | chloromethane;2-[[3-ethyl-2-(ethylamino)pyridin-1-ium-1-yl]methyl]-1,1,1-trifluoro-4-(5-fluoro-2-methoxyphenyl)-4-methylpentan-2-ol |
| SMILES | CCNc1c(CC)ccc[n+]1CC(O)(CC(C)(C)c1cc(F)ccc1OC)C(F)(F)F.CCl |
| InChI | InChI=1S/C23H30F4N2O2.CH3Cl/c1-6-16-9-8-12-29(20(16)28-7-2)15-22(30,23(25,26)27)14-21(3,4)18-13-17(24)10-11-19(18)31-5;1-2/h8-13,30H,6-7,14-15H2,1-5H3;1H3/p+1 |
| InChIKey | HYPFFWGEFHNYDX-UHFFFAOYSA-O |
| XLogP | 5.63 |
| TPSA | 45.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.99 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|