C16H21N3 — CID 143032030
1-N,3-dimethyl-4-N-[(Z)-prop-1-enyl]-1-pyridin-4-ylhex-5-ene-1,4-diimine (PubChem CID 143032030) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 1-N,3-dimethyl-4-N-[(Z)-prop-1-enyl]-1-pyridin-4-ylhex-5-ene-1,4-diimine.
| Compound Name | 1-N,3-dimethyl-4-N-[(Z)-prop-1-enyl]-1-pyridin-4-ylhex-5-ene-1,4-diimine |
|---|---|
| PubChem CID | 143032030 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1-N,3-dimethyl-4-N-[(Z)-prop-1-enyl]-1-pyridin-4-ylhex-5-ene-1,4-diimine |
| SMILES | C=C/C(=N\C=C/C)C(C)C/C(=N\C)c1ccncc1 |
| InChI | InChI=1S/C16H21N3/c1-5-9-19-15(6-2)13(3)12-16(17-4)14-7-10-18-11-8-14/h5-11,13H,2,12H2,1,3-4H3/b9-5-,17-16+,19-15+ |
| InChIKey | LRRFJRBKWZXIFP-PVZLZYHKSA-N |
| XLogP | 3.69 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|