C22H16Cl2N2O3 — CID 143034725
2,4-dichloro-N-[2-[[(1E,3Z)-4-(furan-2-yl)buta-1,3-dienyl]carbamoyl]phenyl]benzamide (PubChem CID 143034725) has the molecular formula C22H16Cl2N2O3 and a molecular weight of 427.29 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[[(1E,3Z)-4-(furan-2-yl)buta-1,3-dienyl]carbamoyl]phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[[(1E,3Z)-4-(furan-2-yl)buta-1,3-dienyl]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 143034725 |
| Molecular Formula | C22H16Cl2N2O3 |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 2,4-dichloro-N-[2-[[(1E,3Z)-4-(furan-2-yl)buta-1,3-dienyl]carbamoyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)N/C=C/C=C\c1ccco1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H16Cl2N2O3/c23-15-10-11-17(19(24)14-15)22(28)26-20-9-2-1-8-18(20)21(27)25-12-4-3-6-16-7-5-13-29-16/h1-14H,(H,25,27)(H,26,28)/b6-3-,12-4+ |
| InChIKey | GSALVFNIHKKSRK-OJCJLYEQSA-N |
| XLogP | 5.80 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|