C19H26F3N7S — CID 143041823
2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-N'-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]ethanimidamide;ethane (PubChem CID 143041823) has the molecular formula C19H26F3N7S and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-N'-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]ethanimidamide;ethane.
| Compound Name | 2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-N'-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]ethanimidamide;ethane |
|---|---|
| PubChem CID | 143041823 |
| Molecular Formula | C19H26F3N7S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[(2-amino-5-cyano-6-methylsulfanylpyrimidin-4-yl)-methylamino]-N'-[(3E,5E)-7,7,7-trifluoro-6-methylhepta-1,3,5-trien-3-yl]ethanimidamide;ethane |
| SMILES | C=CC(=C\C=C(/C)C(F)(F)F)/N=C(\N)CN(C)c1nc(N)nc(SC)c1C#N.CC |
| InChI | InChI=1S/C17H20F3N7S.C2H6/c1-5-11(7-6-10(2)17(18,19)20)24-13(22)9-27(3)14-12(8-21)15(28-4)26-16(23)25-14;1-2/h5-7H,1,9H2,2-4H3,(H2,22,24)(H2,23,25,26);1-2H3/b10-6+,11-7+; |
| InChIKey | NYROYIVVVOQEGS-MODGIHDZSA-N |
| XLogP | 4.05 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|