C13H9BCl3NO4 — CID 143045579
[3-amino-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid (PubChem CID 143045579) has the molecular formula C13H9BCl3NO4 and a molecular weight of 360.39 g/mol. Its IUPAC name is [3-amino-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid.
| Compound Name | [3-amino-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid |
|---|---|
| PubChem CID | 143045579 |
| Molecular Formula | C13H9BCl3NO4 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 358.97 |
| IUPAC Name | [3-amino-5-(2,4,6-trichlorophenoxy)carbonylphenyl]boronic acid |
| SMILES | Nc1cc(B(O)O)cc(C(=O)Oc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H9BCl3NO4/c15-8-4-10(16)12(11(17)5-8)22-13(19)6-1-7(14(20)21)3-9(18)2-6/h1-5,20-21H,18H2 |
| InChIKey | KLXJXSODWKDSNJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|