C18H26N2 — CID 143046923
5-methyl-1-prop-1-en-2-yl-N-[(Z,2E)-2-propylidenehex-3-enyl]pyridin-2-imine (PubChem CID 143046923) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 5-methyl-1-prop-1-en-2-yl-N-[(Z,2E)-2-propylidenehex-3-enyl]pyridin-2-imine.
| Compound Name | 5-methyl-1-prop-1-en-2-yl-N-[(Z,2E)-2-propylidenehex-3-enyl]pyridin-2-imine |
|---|---|
| PubChem CID | 143046923 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 5-methyl-1-prop-1-en-2-yl-N-[(Z,2E)-2-propylidenehex-3-enyl]pyridin-2-imine |
| SMILES | C=C(C)n1cc(C)cc/c1=N\CC(/C=C\CC)=C/CC |
| InChI | InChI=1S/C18H26N2/c1-6-8-10-17(9-7-2)13-19-18-12-11-16(5)14-20(18)15(3)4/h8-12,14H,3,6-7,13H2,1-2,4-5H3/b10-8-,17-9+,19-18+ |
| InChIKey | SAAIZNGFPPBAQJ-BXMPWKCJSA-N |
| XLogP | 4.49 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|