C38H58B2O2 — CID 143047765
2-[9,9-dihexyl-7-(3,3,4,4-tetramethyloxaboretan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyloxaborolane (PubChem CID 143047765) has the molecular formula C38H58B2O2 and a molecular weight of 568.50 g/mol. Its IUPAC name is 2-[9,9-dihexyl-7-(3,3,4,4-tetramethyloxaboretan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyloxaborolane.
| Compound Name | 2-[9,9-dihexyl-7-(3,3,4,4-tetramethyloxaboretan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyloxaborolane |
|---|---|
| PubChem CID | 143047765 |
| Molecular Formula | C38H58B2O2 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.46 |
| IUPAC Name | 2-[9,9-dihexyl-7-(3,3,4,4-tetramethyloxaboretan-2-yl)fluoren-2-yl]-4,4,5,5-tetramethyloxaborolane |
| SMILES | CCCCCCC1(CCCCCC)c2cc(B3CC(C)(C)C(C)(C)O3)ccc2-c2ccc(B3OC(C)(C)C3(C)C)cc21 |
| InChI | InChI=1S/C38H58B2O2/c1-11-13-15-17-23-38(24-18-16-14-12-2)32-25-28(39-27-34(3,4)36(7,8)41-39)19-21-30(32)31-22-20-29(26-33(31)38)40-35(5,6)37(9,10)42-40/h19-22,25-26H,11-18,23-24,27H2,1-10H3 |
| InChIKey | WHYPLVPULQVFTM-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|