C15H22NO4S+ — CID 143048265
[(1S)-1-carboxy-2-[2-[4-(2-methylpropyl)phenyl]-2-sulfanylacetyl]oxyethyl]azanium (PubChem CID 143048265) has the molecular formula C15H22NO4S+ and a molecular weight of 312.41 g/mol. Its IUPAC name is [(1S)-1-carboxy-2-[2-[4-(2-methylpropyl)phenyl]-2-sulfanylacetyl]oxyethyl]azanium.
| Compound Name | [(1S)-1-carboxy-2-[2-[4-(2-methylpropyl)phenyl]-2-sulfanylacetyl]oxyethyl]azanium |
|---|---|
| PubChem CID | 143048265 |
| Molecular Formula | C15H22NO4S+ |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [(1S)-1-carboxy-2-[2-[4-(2-methylpropyl)phenyl]-2-sulfanylacetyl]oxyethyl]azanium |
| SMILES | CC(C)Cc1ccc(C(S)C(=O)OC[C@H]([NH3+])C(=O)O)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-9(2)7-10-3-5-11(6-4-10)13(21)15(19)20-8-12(16)14(17)18/h3-6,9,12-13,21H,7-8,16H2,1-2H3,(H,17,18)/p+1/t12-,13?/m0/s1 |
| InChIKey | GDXHUSBUGHXERH-UEWDXFNNSA-O |
| XLogP | 1.09 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|