C24H27IN4O3 — CID 143053334
N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)-methyl-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-amine (PubChem CID 143053334) has the molecular formula C24H27IN4O3 and a molecular weight of 546.41 g/mol. Its IUPAC name is N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)-methyl-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-amine.
| Compound Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)-methyl-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-amine |
|---|---|
| PubChem CID | 143053334 |
| Molecular Formula | C24H27IN4O3 |
| Molecular Weight | 546.41 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | N-[4-[(5-tert-butyl-1,2-oxazol-3-yl)-methyl-λ3-iodanyl]phenyl]-6,7-dimethoxyquinazolin-4-amine |
| SMILES | COc1cc2ncnc(Nc3ccc(I(C)c4cc(C(C)(C)C)on4)cc3)c2cc1OC |
| InChI | InChI=1S/C24H27IN4O3/c1-24(2,3)21-13-22(29-32-21)25(4)15-7-9-16(10-8-15)28-23-17-11-19(30-5)20(31-6)12-18(17)26-14-27-23/h7-14H,1-6H3,(H,26,27,28) |
| InChIKey | PFPBOGQTPLGSLX-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.41 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|